CAS 858523-47-4 appears in our catalog under these names: 2-Methyl-4-(1h-pyrazol-1-yl)phenylboronic acid, 95%, 2–Methyl–4–(1H–pyrazol–1–yl)phenylboronic acid, (2-Methyl-4-(1H-pyrazol-1-yl)phenyl)boronic acid 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg, 25mg, 100mg.
(2-methyl-4-pyrazol-1-ylphenyl)boronic acid (CAS 858523-47-4) is a chemical compound with the molecular formula C10H11BN2O2 and a molecular weight of 202.02 g/mol. IUPAC name: (2-methyl-4-pyrazol-1-ylphenyl)boronic acid. InChIKey: URUFJWIDOGVQHL-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O2 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | (2-methyl-4-pyrazol-1-ylphenyl)boronic acid |
| InChIKey | URUFJWIDOGVQHL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2C=CC=N2)C)(O)O |
Computed by PubChem (NCBI)