cas: 290331-71-4 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-5-methoxy-1H-indol-2-yl)boronic acid 98% (CAS 290331-71-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277843-1g |
| cas | 290331-71-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 654.06 Pln | |
| Ambeed | 25g | 1516.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A277843 |
[5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 290331-71-4) is a chemical compound with the molecular formula C14H18BNO5 and a molecular weight of 291.11 g/mol. IUPAC name: [5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: PZLVPMBCKHDVKT-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO5 |
|---|---|
| Molecular weight | 291.11 g/mol |
| IUPAC name | [5-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | PZLVPMBCKHDVKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)OC)(O)O |
Computed by PubChem (NCBI)