cas: 6646-70-4 — see every product listed under this CAS number, including other names
(1-Benzyl-1H-benzo[d]imidazol-2-yl)methanol 98+% (CAS 6646-70-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A690925-1g |
| cas | 6646-70-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1249.25 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A690925 |
(1-benzylbenzimidazol-2-yl)methanol (CAS 6646-70-4) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: (1-benzylbenzimidazol-2-yl)methanol. InChIKey: BMKLUFBUYHXGGH-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (1-benzylbenzimidazol-2-yl)methanol |
| InChIKey | BMKLUFBUYHXGGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=C2CO |
Computed by PubChem (NCBI)