CAS 131427-21-9 is the registry number for (1-Benzylindazol-3-yl)methanol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1-benzylindazol-3-yl)methanol (CAS 131427-21-9) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: (1-benzylindazol-3-yl)methanol. InChIKey: AKQDXNFPEFHRLS-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (1-benzylindazol-3-yl)methanol |
| InChIKey | AKQDXNFPEFHRLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=N2)CO |
Computed by PubChem (NCBI)