CAS 18046-35-0 appears in our catalog under these names: (5-Methyl-1h-1,3-benzodiazol-2-yl)(phenyl)methanol, 95%, (5-Methyl-1H-1,3-benzodiazol-2-yl)(phenyl)methanol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
(6-methyl-1H-benzimidazol-2-yl)-phenylmethanol (CAS 18046-35-0) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: (6-methyl-1H-benzimidazol-2-yl)-phenylmethanol. InChIKey: JFCGJONXAJJUDD-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (6-methyl-1H-benzimidazol-2-yl)-phenylmethanol |
| InChIKey | JFCGJONXAJJUDD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)