CAS 293737-75-4 is the registry number for 2-Methyl-5-(6-methyl-1,3-benzoxazol-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)aniline (CAS 293737-75-4) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: 2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)aniline. InChIKey: RGNOSZJCKGNNKE-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-methyl-5-(6-methyl-1,3-benzoxazol-2-yl)aniline |
| InChIKey | RGNOSZJCKGNNKE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(O2)C3=CC(=C(C=C3)C)N |
Computed by PubChem (NCBI)