Products 954272-04-9
CAS 954272-04-9 appears in our catalog under these names: 3-[(2,3-Dihydro-1h-indol-1-yl)carbonyl]aniline, 95%, 3-(2,3-dihydro-1H-indole-1-carbonyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
(3-aminophenyl)-(2,3-dihydroindol-1-yl)methanone (CAS 954272-04-9) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: (3-aminophenyl)-(2,3-dihydroindol-1-yl)methanone. InChIKey: IMSWSKYWTRVQCW-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (3-aminophenyl)-(2,3-dihydroindol-1-yl)methanone |
| InChIKey | IMSWSKYWTRVQCW-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)