CAS 2304635-78-5 appears in our catalog under these names: (1-Methyl-1h-pyrrolo[2,3-b]pyridin-4-yl)boronic acid, 95%, (1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid, 98%, 98%, (1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
(1-methylpyrrolo[2,3-b]pyridin-4-yl)boronic acid (CAS 2304635-78-5) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (1-methylpyrrolo[2,3-b]pyridin-4-yl)boronic acid. InChIKey: XIWNHJLMNFUQIW-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (1-methylpyrrolo[2,3-b]pyridin-4-yl)boronic acid |
| InChIKey | XIWNHJLMNFUQIW-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN(C2=NC=C1)C)(O)O |
Computed by PubChem (NCBI)