CAS 521985-24-0 appears in our catalog under these names: 1-Methyl-1H-pyrrolo[2,3-b]pyridine-3-boronic acid, 98%, (1-Methyl-1H-pyrrolo(2,3-b)pyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
(1-methylpyrrolo[2,3-b]pyridin-3-yl)boronic acid (CAS 521985-24-0) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (1-methylpyrrolo[2,3-b]pyridin-3-yl)boronic acid. InChIKey: SMKPJMHERWBRIS-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (1-methylpyrrolo[2,3-b]pyridin-3-yl)boronic acid |
| InChIKey | SMKPJMHERWBRIS-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=C1C=CC=N2)C)(O)O |
Computed by PubChem (NCBI)