CAS 1001907-58-9 appears in our catalog under these names: 2-Methyl-2h-indazole-7-boronic acid, 95%, (2-Methyl-2H-indazol-7-yl)boronic acid, 98%, 98%, 2-METHYLINDAZOLE-7-BORONIC ACID, 95%, (2-Methyl-2H-indazol-7-yl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(2-methylindazol-7-yl)boronic acid (CAS 1001907-58-9) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (2-methylindazol-7-yl)boronic acid. InChIKey: PNVSRHLDCRSFAZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (2-methylindazol-7-yl)boronic acid |
| InChIKey | PNVSRHLDCRSFAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC2=CN(N=C12)C)(O)O |
Computed by PubChem (NCBI)