CAS 1072945-87-9 is the registry number for 1-Methyl-1H-benzoimidazole-6-boronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3-methylbenzimidazol-5-yl)boronic acid (CAS 1072945-87-9) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (3-methylbenzimidazol-5-yl)boronic acid. InChIKey: AOOJQSARVKLHLF-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (3-methylbenzimidazol-5-yl)boronic acid |
| InChIKey | AOOJQSARVKLHLF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=CN2C)(O)O |
Computed by PubChem (NCBI)