CAS 1310383-41-5 appears in our catalog under these names: 3-Methyl-1h-indazole-4-boronic acid, 95%, (3-Methyl-1H-indazol-4-yl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
(3-methyl-2H-indazol-4-yl)boronic acid (CAS 1310383-41-5) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (3-methyl-2H-indazol-4-yl)boronic acid. InChIKey: SRVMIYRNCHTCIN-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (3-methyl-2H-indazol-4-yl)boronic acid |
| InChIKey | SRVMIYRNCHTCIN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC2=NNC(=C12)C)(O)O |
Computed by PubChem (NCBI)