cas: 15573-40-7 — see every product listed under this CAS number, including other names
(1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid, 95%, 95% (CAS 15573-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112O6P-100mg |
| cas | 15573-40-7 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 500mg | 386.00 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1480.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid (CAS 15573-40-7) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid. InChIKey: ILUAAIDVFMVTAU-PHDIDXHHSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid |
| InChIKey | ILUAAIDVFMVTAU-PHDIDXHHSA-N |
| SMILES | C1C=CC[C@H]([C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)