CAS 15573-40-7 appears in our catalog under these names: Trans-cyclohex-4-ene-1,2-dicarboxylic acid, 95%, (1R,2R)-Cyclohex-4-ene-1,2-dicarboxylic acid, 95%, (R,R)-rel-Cyclohex-4-ene-1,2-dicarboxylic Acid, trans-4-Cyclohexene-1,2-dicarboxylic acid, 97%, trans-4-Cyclohexene-1,2-dicarboxylic acid 95%. Offered by: Combi-blocks, TRC, AmBeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 10g, 25g, 100mg, 5g, 500mg.
(1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid (CAS 15573-40-7) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid. InChIKey: ILUAAIDVFMVTAU-PHDIDXHHSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid |
| InChIKey | ILUAAIDVFMVTAU-PHDIDXHHSA-N |
| SMILES | C1C=CC[C@H]([C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)