cas: 15573-40-7 — see every product listed under this CAS number, including other names
trans-4-Cyclohexene-1,2-dicarboxylic acid, 97% (CAS 15573-40-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A145223-25g |
| cas | 15573-40-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 11163.04 Pln | |
| AmBeed | 10g | 5115.25 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid (CAS 15573-40-7) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid. InChIKey: ILUAAIDVFMVTAU-PHDIDXHHSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid |
| InChIKey | ILUAAIDVFMVTAU-PHDIDXHHSA-N |
| SMILES | C1C=CC[C@H]([C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)