cas: 128110-37-2 — see every product listed under this CAS number, including other names
(1R,2S)-2-Aminocyclopentane-1-carboxylic acid hydrochloride, 95% (CAS 128110-37-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620381-100MG |
| cas | 128110-37-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 1008.00 Pln | |
| Fluorochem | 1g | 2590.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 128110-37-2) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: LVBDVNLIEHCCTP-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | LVBDVNLIEHCCTP-JBUOLDKXSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)