CAS 128052-92-6 appears in our catalog under these names: Cis-2-amino-cyclopentanecarboxylic acid hydrochloride, 95%, (1S,2R)-2-Aminocyclopentanecarboxylic acid hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Cis-(1S,2R)-2-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 128052-92-6) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: cis-(1S,2R)-2-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: LVBDVNLIEHCCTP-UYXJWNHNSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | cis-(1S,2R)-2-aminocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | LVBDVNLIEHCCTP-UYXJWNHNSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)