CAS 128110-37-2 appears in our catalog under these names: (1R,2S)-2-Aminocyclopentanecarboxylic acid hydrochloride, 95+%, (1R,2S)-(-)-2-Amino-1-cyclopentanecarboxylic acid hydrochloride, 95%, (1R,2S)-2-Aminocyclopentane-1-carboxylic acid hydrochloride, 95%. Offered by: AmBeed, Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 128110-37-2) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: LVBDVNLIEHCCTP-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | LVBDVNLIEHCCTP-JBUOLDKXSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)