CAS 88335-97-1 appears in our catalog under these names: (1R,2R)-2-(Methoxycarbonyl)cyclopropanecarboxylic acid, 97%, 97%, (1R,2R)-2-(Methoxycarbonyl)cyclopropanecarboxylic acid, 97%, (1R,2R)-2-(Methoxycarbonyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g, 25g.
Trans-(1R,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 88335-97-1) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: trans-(1R,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-QWWZWVQMSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | trans-(1R,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-QWWZWVQMSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H]1C(=O)O |
Computed by PubChem (NCBI)