CAS 88335-96-0 appears in our catalog under these names: (1S,2S)-2-(Methoxycarbonyl)cyclopropanecarboxylic acid, 97%, (1S,2S)-2-(Methoxycarbonyl)cyclopropanecarboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg.
Trans-(1S,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CAS 88335-96-0) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: trans-(1S,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: IRRAJLZEAOBJIV-IMJSIDKUSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | trans-(1S,2S)-2-methoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | IRRAJLZEAOBJIV-IMJSIDKUSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)