(1R,2S,5R)-2-Isopropyl-5-Methylcyclohexanecarboxylic Acid, 97%, 97%
cas: 16052-40-7 — see every product listed under this CAS number, including other names
(1R,2S,5R)-2-Isopropyl-5-Methylcyclohexanecarboxylic Acid, 97%, 97% (CAS 16052-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RZK-100mg |
| cas | 16052-40-7 |
| size | 100mg |
| availability | 150g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 25g | 587.60 Pln | |
| Chemat | 50g | 1062.80 Pln | |
| Chemat | 100g | 1998.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid (CAS 16052-40-7) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid. InChIKey: MNVSUVYRIVXDBK-KXUCPTDWSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid |
| InChIKey | MNVSUVYRIVXDBK-KXUCPTDWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Cyclohexanecarboxylic acid, 5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-, p-Menthane-3-carboxylic acid, (1R,3R,4S)-, (1R,3R,4S)-p-menthane-3-carboxylic acid, p-Menthane-3-carboxylic acid, (1R,3R,4S)-(-)-, (1R,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexanecarboxylic acid, (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic acid, (1R,2S,5R)-2-Isopropyl-5-methyl-cyclohexanecarboxylic acid, (-)-Menthylformic acid, L-menthol carboxylic acid, (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid