cas: 489446-85-7 — see every product listed under this CAS number, including other names
(1R,3R)-N-Boc-1-Aminocyclopentane-3-Carboxylic Acid, 98%, 98% (CAS 489446-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140J5-100mg |
| cas | 489446-85-7 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1782.80 Pln | |
| Chemat | 25g | 5958.80 Pln | |
| Chemat | 50g | 10096.40 Pln | |
| Chemat | 100g | 19989.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 489446-85-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: RNJQBGXOSAQQDG-HTQZYQBOSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | RNJQBGXOSAQQDG-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)