CAS 261165-05-3 appears in our catalog under these names: BOC–(1S,3R)–3–Aminocyclopentanecarboxylic acid, BOC-(1S,3R)-3-aminocyclopentanecarboxylic acid, 98.0%, (1R,3S)-N-BOC-1-Aminocyclopentane-3-carboxylic acid, 95%, 98% ee, Boc-D-AcPAC 97%, (1S,3R)-3-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 95%, 95%. Offered by: GLPBio, MedChemExpress, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 50mg, 1 g, 10 g, 500 mg, 5 g, 25 g, 1g, 250MG.
Cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 261165-05-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: RNJQBGXOSAQQDG-JGVFFNPUSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | cis-(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | RNJQBGXOSAQQDG-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)