CAS 489446-85-7 appears in our catalog under these names: (1R,3R)-3-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 98%, (1R,3R)-N-BOC-1-Aminocyclopentane-3-carboxylic acid, 95%, 98% ee, (1R,3R)-N-Boc-1-Aminocyclopentane-3-Carboxylic Acid, 98%, 98%, (1R,3R)-3-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 97%. Offered by: Combi-blocks, Thermo Scientific (Acros), Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 500MG, 50g, 100g.
Trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 489446-85-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: RNJQBGXOSAQQDG-HTQZYQBOSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | RNJQBGXOSAQQDG-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)