cas: 1259278-10-8 — see every product listed under this CAS number, including other names
(1R,3S)-3-(Carbobenzoxyamino)cyclohexanecarboxylic Acid, >98.0%(HPLC)(T) (CAS 1259278-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2400-100MG |
| cas | 1259278-10-8 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 1175.55 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Cis-(1R,3S)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 1259278-10-8) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: cis-(1R,3S)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: LTEORMGXUMWZCU-OLZOCXBDSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | cis-(1R,3S)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | LTEORMGXUMWZCU-OLZOCXBDSA-N |
| SMILES | C1C[C@H](C[C@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)