CAS 1035325-24-6 is the registry number for (1R,3R)-3-(((Benzyloxy)carbonyl)amino)cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, 250mg, on request.
Trans-(1R,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 1035325-24-6) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: trans-(1R,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: LTEORMGXUMWZCU-CHWSQXEVSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | trans-(1R,3R)-3-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | LTEORMGXUMWZCU-CHWSQXEVSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)