cas: 28269-03-6 — see every product listed under this CAS number, including other names
(1R,2R)-rel-Dimethyl 4-oxocyclopentane-1,2-dicarboxylate, 97%, 97% (CAS 28269-03-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BE2U-100mg |
| cas | 28269-03-6 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 242.00 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 50g | 1096.40 Pln | |
| Chemat | 100g | 1782.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate (CAS 28269-03-6) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: trans-dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate. InChIKey: GMKJWKXCHOWVDN-RNFRBKRXSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | trans-dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate |
| InChIKey | GMKJWKXCHOWVDN-RNFRBKRXSA-N |
| SMILES | COC(=O)[C@@H]1CC(=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)