Products 6453-07-2

CAS 6453-07-2 is the registry number for Dimethyl 4-oxocyclopentane-1,2-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 50g, 250g, 500g, 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Dimethyl 4-oxocyclopentane-1,2-dicarboxylate (CAS 6453-07-2) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: dimethyl 4-oxocyclopentane-1,2-dicarboxylate. InChIKey: GMKJWKXCHOWVDN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O5
Molecular weight200.19 g/mol
IUPAC namedimethyl 4-oxocyclopentane-1,2-dicarboxylate
InChIKeyGMKJWKXCHOWVDN-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(=O)CC1C(=O)OC

Computed by PubChem (NCBI)