cas: 766498-73-1 — see every product listed under this CAS number, including other names
(1S)-1-(4-CHLOROPHENYL)-2,2,2-TRIFLUOROETHYLAMINE, 97%, 97% (CAS 766498-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116W38-100mg |
| cas | 766498-73-1 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2416.40 Pln | |
| Chemat | 500mg | 7336.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine (CAS 766498-73-1) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: (1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZGFGADXCVWZZHD-ZETCQYMHSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | (1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZGFGADXCVWZZHD-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)