Products 766498-73-1
CAS 766498-73-1 appears in our catalog under these names: (1S)-1-(4-Chlorophenyl)-2,2,2-trifluoroethylamine, 95%, (1S)-1-(4-CHLOROPHENYL)-2,2,2-TRIFLUOROETHYLAMINE, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg.
(1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine (CAS 766498-73-1) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: (1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZGFGADXCVWZZHD-ZETCQYMHSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | (1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZGFGADXCVWZZHD-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)