cas: 174291-97-5 — see every product listed under this CAS number, including other names
(1S,2S)-N-p-Tosyl-1,2-cyclohexanediamine, 97% (CAS 174291-97-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F611280-5G |
| cas | 174291-97-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 378.01 Pln | |
| Fluorochem | 10g | 674.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide (CAS 174291-97-5) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide. InChIKey: VVOFSHARRCJLLA-STQMWFEESA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | VVOFSHARRCJLLA-STQMWFEESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H]2CCCC[C@@H]2N |
Computed by PubChem (NCBI)