CAS 58825-94-8 is the registry number for N–((trans–2–aminocyclohexyl)–4–methylbenzenesulfonamide. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide (CAS 58825-94-8) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide. InChIKey: VVOFSHARRCJLLA-CHWSQXEVSA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | VVOFSHARRCJLLA-CHWSQXEVSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H]2CCCC[C@H]2N |
Computed by PubChem (NCBI)