cas: 161601-29-2 — see every product listed under this CAS number, including other names
(1S,3S)-3-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 98%, 98% (CAS 161601-29-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VQT-100mg |
| cas | 161601-29-2 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 500mg | 299.60 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1994.00 Pln | |
| Chemat | 10g | 3438.80 Pln | |
| Chemat | 25g | 6678.80 Pln | |
| Chemat | 100g | 25370.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 161601-29-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: trans-(1S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: RNJQBGXOSAQQDG-YUMQZZPRSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | trans-(1S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | RNJQBGXOSAQQDG-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)