(2,3,6-Trifluorophenyl)hydrazine hydrochloride, 98%
cas: 2137836-61-2 — see every product listed under this CAS number, including other names
(2,3,6-Trifluorophenyl)hydrazine hydrochloride, 98% (CAS 2137836-61-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1197035-250mg |
| cas | 2137836-61-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 2061.38 Pln | |
| Ambeed | 5g | 7340.19 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 864.16 Pln | |
| BLDpharm | 1g | 2213.69 Pln | |
| BLDpharm | 5g | 7911.68 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 966.80 Pln | |
| Chemat | 1g | 2507.60 Pln | |
| Fluorochem | 100mg | 1101.71 Pln | |
| Fluorochem | 250mg | 1788.97 Pln | |
| Fluorochem | 1g | 4642.13 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2,3,6-trifluorophenyl)hydrazine;hydrochloride (CAS 2137836-61-2) is a chemical compound with the molecular formula C6H6ClF3N2 and a molecular weight of 198.57 g/mol. IUPAC name: (2,3,6-trifluorophenyl)hydrazine;hydrochloride. InChIKey: YTXCKYWGUVFJGN-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | (2,3,6-trifluorophenyl)hydrazine;hydrochloride |
| InChIKey | YTXCKYWGUVFJGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)NN)F)F.Cl |
Computed by PubChem (NCBI)