Products 2137836-61-2
CAS 2137836-61-2 appears in our catalog under these names: (2,3,6-Trifluorophenyl)hydrazine hydrochloride, (2,3,6-Trifluorophenyl)hydrazine hydrochloride 98%, (2,3,6-Trifluorophenyl)hydrazine hydrochloride, 98%, 98%, (2,3,6-trifluorophenyl)hydrazine hydrochloride, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
(2,3,6-trifluorophenyl)hydrazine;hydrochloride (CAS 2137836-61-2) is a chemical compound with the molecular formula C6H6ClF3N2 and a molecular weight of 198.57 g/mol. IUPAC name: (2,3,6-trifluorophenyl)hydrazine;hydrochloride. InChIKey: YTXCKYWGUVFJGN-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | (2,3,6-trifluorophenyl)hydrazine;hydrochloride |
| InChIKey | YTXCKYWGUVFJGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)NN)F)F.Cl |
Computed by PubChem (NCBI)