cas: 1889-67-4 — see every product listed under this CAS number, including other names
(2,3-Dimethylbutane-2,3-diyl)dibenzene, 95% (CAS 1889-67-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240763-25G |
| cas | 1889-67-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 268.67 Pln | |
| Fluorochem | 500g | 893.45 Pln | |
| Fluorochem | 1kg | 1414.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2,3-dimethyl-3-phenylbutan-2-yl)benzene (CAS 1889-67-4) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: (2,3-dimethyl-3-phenylbutan-2-yl)benzene. InChIKey: HGTUJZTUQFXBIH-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | (2,3-dimethyl-3-phenylbutan-2-yl)benzene |
| InChIKey | HGTUJZTUQFXBIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)