cas: 1889-67-4 — see every product listed under this CAS number, including other names
2,3-Dimethyl-2,3-diphenylbutane, 98.79% (CAS 1889-67-4) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 500 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W087905-50 g |
| cas | 1889-67-4 |
| size | 50 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 301.12 Pln | |
| MedChemExpress | 500 g | 983.78 Pln | |
| MedChemExpress | 100 g | 407.93 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.79% |
(2,3-dimethyl-3-phenylbutan-2-yl)benzene (CAS 1889-67-4) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: (2,3-dimethyl-3-phenylbutan-2-yl)benzene. InChIKey: HGTUJZTUQFXBIH-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | (2,3-dimethyl-3-phenylbutan-2-yl)benzene |
| InChIKey | HGTUJZTUQFXBIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)