cas: 1889-67-4 — see every product listed under this CAS number, including other names
2,3-Dimethyl-2,3-diphenylbutane, 95%+, 95%+ (CAS 1889-67-4) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113HHL-1kg |
| cas | 1889-67-4 |
| size | 1kg |
| availability | 7000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 995.60 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 500g | 576.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
(2,3-dimethyl-3-phenylbutan-2-yl)benzene (CAS 1889-67-4) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: (2,3-dimethyl-3-phenylbutan-2-yl)benzene. InChIKey: HGTUJZTUQFXBIH-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | (2,3-dimethyl-3-phenylbutan-2-yl)benzene |
| InChIKey | HGTUJZTUQFXBIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)