cas: 1889-67-4 — see every product listed under this CAS number, including other names
2,3-Dimethyl-2,3-diphenylbutane 95% (CAS 1889-67-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A271443-25g |
| cas | 1889-67-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 142.31 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A271443 |
(2,3-dimethyl-3-phenylbutan-2-yl)benzene (CAS 1889-67-4) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: (2,3-dimethyl-3-phenylbutan-2-yl)benzene. InChIKey: HGTUJZTUQFXBIH-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | (2,3-dimethyl-3-phenylbutan-2-yl)benzene |
| InChIKey | HGTUJZTUQFXBIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(C)(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)