cas: 871125-73-4 — see every product listed under this CAS number, including other names
(2,4,6-Trifluoro-3-isopropoxyphenyl)boronic acid (CAS 871125-73-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694067-5G |
| cas | 871125-73-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2439.78 Pln | |
| Fluorochem | 10g | 4095.45 Pln |
| delivery time | 3-4 weeks |
|---|
(2,4,6-trifluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 871125-73-4) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: (2,4,6-trifluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: ROCZYUISNXPFSX-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | (2,4,6-trifluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | ROCZYUISNXPFSX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)