CAS 871125-73-4 appears in our catalog under these names: 3-Isopropoxy-2,4,6-trifluorophenylboronic acid, 98%, (2,4,6-Trifluoro-3-isopropoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(2,4,6-trifluoro-3-propan-2-yloxyphenyl)boronic acid (CAS 871125-73-4) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: (2,4,6-trifluoro-3-propan-2-yloxyphenyl)boronic acid. InChIKey: ROCZYUISNXPFSX-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | (2,4,6-trifluoro-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | ROCZYUISNXPFSX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)