CAS 871332-96-6 appears in our catalog under these names: 3-Ethoxy-5-trifluoromethylphenylboronic acid, 98%, 3–Ethoxy–5–trifluoromethylphenylboronic acid, 3-Ethoxy-5-(trifluoromethyl)benzeneboronic acid, 98% , 3-Ethoxy-5-(trifluoromethyl)phenylboronic acid, 98%, 98%, 3-Ethoxy-5-(trifluoromethyl)phenylboronic acid, ≥95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 1g, 500mg.
[3-ethoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 871332-96-6) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [3-ethoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: ATZRXKHRSOTBAM-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [3-ethoxy-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | ATZRXKHRSOTBAM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OCC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)