Products 1026796-35-9
CAS 1026796-35-9 appears in our catalog under these names: 3-Ethoxy-4-(trifluoromethyl)phenylboronic acid, 98%, 3-Ethoxy-4-(trifluoromethyl)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g.
[3-ethoxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1026796-35-9) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [3-ethoxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: MBHNHSFMGPDDDM-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [3-ethoxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MBHNHSFMGPDDDM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)OCC)(O)O |
Computed by PubChem (NCBI)