Products 313545-39-0
CAS 313545-39-0 appears in our catalog under these names: 4-Ethoxy-2-(trifluoromethyl)phenylboronic acid, 98%, (4-Ethoxy-2-(trifluoromethyl)phenyl)boronic acid, 98%, (4–Ethoxy–2–(trifluoromethyl)phenyl)boronic acid, (4-Ethoxy-2-(trifluoromethyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 100mg, 10g.
[4-ethoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 313545-39-0) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [4-ethoxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: OGQUWAGSWMWDRG-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [4-ethoxy-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | OGQUWAGSWMWDRG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)