(2,4-Di-tert-butylphenyl)boronic acid, 95%
cas: 3085872-64-3 — see every product listed under this CAS number, including other names
(2,4-Di-tert-butylphenyl)boronic acid, 95% (CAS 3085872-64-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1543839-100mg |
| cas | 3085872-64-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| Ambeed | 5g | 3819.13 Pln | |
| Ambeed | 10g | 6439.06 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 542.06 Pln | |
| BLDpharm | 1g | 1297.35 Pln | |
| BLDpharm | 5g | 4107.47 Pln | |
| BLDpharm | 10g | 6939.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2,4-ditert-butylphenyl)boronic acid (CAS 3085872-64-3) is a chemical compound with the molecular formula C14H23BO2 and a molecular weight of 234.14 g/mol. IUPAC name: (2,4-ditert-butylphenyl)boronic acid. InChIKey: JYJACEBIVXZPDT-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2 |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | (2,4-ditert-butylphenyl)boronic acid |
| InChIKey | JYJACEBIVXZPDT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(C)(C)C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)