Products 3085872-64-3

CAS 3085872-64-3 is the registry number for (2,4-Di-tert-butylphenyl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(2,4-ditert-butylphenyl)boronic acid (CAS 3085872-64-3) is a chemical compound with the molecular formula C14H23BO2 and a molecular weight of 234.14 g/mol. IUPAC name: (2,4-ditert-butylphenyl)boronic acid. InChIKey: JYJACEBIVXZPDT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23BO2
Molecular weight234.14 g/mol
IUPAC name(2,4-ditert-butylphenyl)boronic acid
InChIKeyJYJACEBIVXZPDT-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)C(C)(C)C)C(C)(C)C)(O)O

Computed by PubChem (NCBI)