CAS 1252935-67-3 is the registry number for (2,5-Di-tert-butylphenyl)boronicacid, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,5-ditert-butylphenyl)boronic acid (CAS 1252935-67-3) is a chemical compound with the molecular formula C14H23BO2 and a molecular weight of 234.14 g/mol. IUPAC name: (2,5-ditert-butylphenyl)boronic acid. InChIKey: VNKLXYSLUFNZQU-UHFFFAOYSA-N.
| Molecular formula | C14H23BO2 |
|---|---|
| Molecular weight | 234.14 g/mol |
| IUPAC name | (2,5-ditert-butylphenyl)boronic acid |
| InChIKey | VNKLXYSLUFNZQU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(C)(C)C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)