(2,4-Dichloro-5-propoxyphenyl)boronic acid, 98%
cas: 1256346-45-8 — see every product listed under this CAS number, including other names
(2,4-Dichloro-5-propoxyphenyl)boronic acid, 98% (CAS 1256346-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F228602-100MG |
| cas | 1256346-45-8 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 25g | 2879.06 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 914.15 Pln | |
| BLDpharm | 25g | 3102.27 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(2,4-dichloro-5-propoxyphenyl)boronic acid (CAS 1256346-45-8) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (2,4-dichloro-5-propoxyphenyl)boronic acid. InChIKey: IGWAPOTUMUZOAX-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O3 |
|---|---|
| Molecular weight | 248.90 g/mol |
| IUPAC name | (2,4-dichloro-5-propoxyphenyl)boronic acid |
| InChIKey | IGWAPOTUMUZOAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OCCC)(O)O |
Computed by PubChem (NCBI)