Products 1256346-45-8
CAS 1256346-45-8 appears in our catalog under these names: (2,4-Dichloro-5-propoxyphenyl)boronic acid, 98%, 2,4-Dichloro-5-propoxyphenylboronic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
(2,4-dichloro-5-propoxyphenyl)boronic acid (CAS 1256346-45-8) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (2,4-dichloro-5-propoxyphenyl)boronic acid. InChIKey: IGWAPOTUMUZOAX-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O3 |
|---|---|
| Molecular weight | 248.90 g/mol |
| IUPAC name | (2,4-dichloro-5-propoxyphenyl)boronic acid |
| InChIKey | IGWAPOTUMUZOAX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OCCC)(O)O |
Computed by PubChem (NCBI)