cas: 41351-30-8 — see every product listed under this CAS number, including other names
(2,4-Dimethoxyphenyl)(4-hydroxyphenyl)methanone, 99%, 99% (CAS 41351-30-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FTG-1g |
| cas | 41351-30-8 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 458.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone (CAS 41351-30-8) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: (2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: QEHRETCJMLQPCR-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (2,4-dimethoxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | QEHRETCJMLQPCR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)